C21H27IN4O3 — CID 109480055
N-ethyl-2-(2-methylphenyl)-N'-[(2-nitrophenyl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 109480055) has the molecular formula C21H27IN4O3 and a molecular weight of 510.38 g/mol. Its IUPAC name is N-ethyl-2-(2-methylphenyl)-N'-[(2-nitrophenyl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2-(2-methylphenyl)-N'-[(2-nitrophenyl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109480055 |
| Molecular Formula | C21H27IN4O3 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | N-ethyl-2-(2-methylphenyl)-N'-[(2-nitrophenyl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1[N+](=O)[O-])N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C21H26N4O3.HI/c1-3-22-21(23-14-17-9-5-7-11-19(17)25(26)27)24-12-13-28-20(15-24)18-10-6-4-8-16(18)2;/h4-11,20H,3,12-15H2,1-2H3,(H,22,23);1H |
| InChIKey | FEZCOAIGEWFOSG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|