C22H26FIN4O — CID 109480724
N'-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 109480724) has the molecular formula C22H26FIN4O and a molecular weight of 508.38 g/mol. Its IUPAC name is N'-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109480724 |
| Molecular Formula | C22H26FIN4O |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N'-[(4-cyano-2-fluorophenyl)methyl]-N-ethyl-2-(2-methylphenyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C#N)cc1F)N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C22H25FN4O.HI/c1-3-25-22(26-14-18-9-8-17(13-24)12-20(18)23)27-10-11-28-21(15-27)19-7-5-4-6-16(19)2;/h4-9,12,21H,3,10-11,14-15H2,1-2H3,(H,25,26);1H |
| InChIKey | GBKRDXABONWILW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|