C16H24N4O3S2 — CID 119144866
N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119144866) has the molecular formula C16H24N4O3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119144866 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C16H24N4O3S2/c1-2-18-16(19-7-10-3-6-15(24-10)25(17,21)22)20-8-11-12(9-20)14-5-4-13(11)23-14/h3,6,11-14H,2,4-5,7-9H2,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | AWPLCYGQHDNNJM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|