C19H29IN4O3S — CID 119144355
N-ethyl-N'-[[4-(methanesulfonamido)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119144355) has the molecular formula C19H29IN4O3S and a molecular weight of 520.44 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(methanesulfonamido)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[4-(methanesulfonamido)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119144355 |
| Molecular Formula | C19H29IN4O3S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | N-ethyl-N'-[[4-(methanesulfonamido)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NS(C)(=O)=O)cc1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C19H28N4O3S.HI/c1-3-20-19(23-11-15-16(12-23)18-9-8-17(15)26-18)21-10-13-4-6-14(7-5-13)22-27(2,24)25;/h4-7,15-18,22H,3,8-12H2,1-2H3,(H,20,21);1H |
| InChIKey | FIVQSHIRDMHKJN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|