C22H30N4O — CID 119145272
N'-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide (PubChem CID 119145272) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is N'-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide.
| Compound Name | N'-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 119145272 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N'-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-ethyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc2[nH]c(C)c(C)c2c1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C22H30N4O/c1-4-23-22(26-11-17-18(12-26)21-8-7-20(17)27-21)24-10-15-5-6-19-16(9-15)13(2)14(3)25-19/h5-6,9,17-18,20-21,25H,4,7-8,10-12H2,1-3H3,(H,23,24) |
| InChIKey | KCNJUVOCOLMFHS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|