C23H30IN3O3 — CID 109425761
methyl 4-[[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 109425761) has the molecular formula C23H30IN3O3 and a molecular weight of 523.42 g/mol. Its IUPAC name is methyl 4-[[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 109425761 |
| Molecular Formula | C23H30IN3O3 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | methyl 4-[[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)OC)cc1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H29N3O3.HI/c1-3-24-23(25-17-18-9-11-19(12-10-18)22(27)28-2)26-15-13-21(14-16-26)29-20-7-5-4-6-8-20;/h4-12,21H,3,13-17H2,1-2H3,(H,24,25);1H |
| InChIKey | WAMSSVXZZLIBGM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|