C27H33IN4O2 — CID 109426987
N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109426987) has the molecular formula C27H33IN4O2 and a molecular weight of 572.49 g/mol. Its IUPAC name is N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109426987 |
| Molecular Formula | C27H33IN4O2 |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccccc2=O)cc1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C27H32N4O2.HI/c1-2-28-27(30-18-15-25(16-19-30)33-24-8-4-3-5-9-24)29-20-22-11-13-23(14-12-22)21-31-17-7-6-10-26(31)32;/h3-14,17,25H,2,15-16,18-21H2,1H3,(H,28,29);1H |
| InChIKey | BNGKRXSWTPIKOV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|