C26H30N4O — CID 111723813
N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 111723813) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723813 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N-ethyl-N'-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccccc2=O)cc1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C26H30N4O/c1-2-27-26(30-17-15-24(20-30)23-8-4-3-5-9-23)28-18-21-11-13-22(14-12-21)19-29-16-7-6-10-25(29)31/h3-14,16,24H,2,15,17-20H2,1H3,(H,27,28) |
| InChIKey | OKFBRQPBYDBVPL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|