C25H33IN4O — CID 111723344
N-ethyl-N'-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111723344) has the molecular formula C25H33IN4O and a molecular weight of 532.47 g/mol. Its IUPAC name is N-ethyl-N'-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111723344 |
| Molecular Formula | C25H33IN4O |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | N-ethyl-N'-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCCC1=O)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C25H32N4O.HI/c1-2-26-25(29-16-14-23(19-29)20-9-4-3-5-10-20)27-17-21-11-6-7-12-22(21)18-28-15-8-13-24(28)30;/h3-7,9-12,23H,2,8,13-19H2,1H3,(H,26,27);1H |
| InChIKey | OVFHNKGGKSRYEH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|