C24H33N3O4 — CID 109425734
N-ethyl-4-phenoxy-N'-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1-carboximidamide (PubChem CID 109425734) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-ethyl-4-phenoxy-N'-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-phenoxy-N'-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109425734 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-ethyl-4-phenoxy-N'-[(2,4,5-trimethoxyphenyl)methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1OC)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-5-25-24(26-17-18-15-22(29-3)23(30-4)16-21(18)28-2)27-13-11-20(12-14-27)31-19-9-7-6-8-10-19/h6-10,15-16,20H,5,11-14,17H2,1-4H3,(H,25,26) |
| InChIKey | HUTPSBWKIBWWBX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|