C14H24N4OS — CID 111959237
4-ethoxy-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidine-1-carboximidamide (PubChem CID 111959237) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959237 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCc2cnc(C)s2)CC1 |
| InChI | InChI=1S/C14H24N4OS/c1-4-19-12-5-7-18(8-6-12)14(15-3)17-10-13-9-16-11(2)20-13/h9,12H,4-8,10H2,1-3H3,(H,15,17) |
| InChIKey | HXIFOCUOPRXDOV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|