C16H27N5O2S — CID 111729911
tert-butyl N-[1-[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111729911) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111729911 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | tert-butyl N-[1-[N'-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(\NCc1cnc(C)s1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27N5O2S/c1-11-18-8-13(24-11)9-19-14(17-5)21-7-6-12(10-21)20-15(22)23-16(2,3)4/h8,12H,6-7,9-10H2,1-5H3,(H,17,19)(H,20,22) |
| InChIKey | YBZMGHQYCGYIIW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|