C19H31N5O3 — CID 111728943
tert-butyl N-[1-[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111728943) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl N-[1-[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111728943 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tert-butyl N-[1-[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCOc1ncccc1CN/C(=N/C)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H31N5O3/c1-6-26-16-14(8-7-10-21-16)12-22-17(20-5)24-11-9-15(13-24)23-18(25)27-19(2,3)4/h7-8,10,15H,6,9,11-13H2,1-5H3,(H,20,22)(H,23,25) |
| InChIKey | AHLAEFSYBZAYSC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|