C18H25IN4O3S2 — CID 111731780
3-(4-methoxyphenyl)-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111731780) has the molecular formula C18H25IN4O3S2 and a molecular weight of 536.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(4-methoxyphenyl)-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111731780 |
| Molecular Formula | C18H25IN4O3S2 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 3-(4-methoxyphenyl)-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)s1)N1CCC(c2ccc(OC)cc2)C1.I |
| InChI | InChI=1S/C18H24N4O3S2.HI/c1-20-18(21-11-16-7-8-17(26-16)27(19,23)24)22-10-9-14(12-22)13-3-5-15(25-2)6-4-13;/h3-8,14H,9-12H2,1-2H3,(H,20,21)(H2,19,23,24);1H |
| InChIKey | WZBMZGWWFPTICI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|