C23H30N4O3S — CID 111731273
N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111731273) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111731273 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC2CC2)cc1)N1CCC(c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C23H30N4O3S/c1-24-23(27-14-13-19(16-27)18-5-9-21(30-2)10-6-18)25-15-17-3-11-22(12-4-17)31(28,29)26-20-7-8-20/h3-6,9-12,19-20,26H,7-8,13-16H2,1-2H3,(H,24,25) |
| InChIKey | YYURLKOZEFIGDC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|