C21H29IN4O3S — CID 111272770
3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111272770) has the molecular formula C21H29IN4O3S and a molecular weight of 544.46 g/mol. Its IUPAC name is 3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111272770 |
| Molecular Formula | C21H29IN4O3S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 3-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC2CC2)cc1)N(C)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C21H28N4O3S.HI/c1-22-21(25(2)15-17-4-10-19(28-3)11-5-17)23-14-16-6-12-20(13-7-16)29(26,27)24-18-8-9-18;/h4-7,10-13,18,24H,8-9,14-15H2,1-3H3,(H,22,23);1H |
| InChIKey | TXPVRBYUJRVIFP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|