C16H24IN5O — CID 111272644
1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111272644) has the molecular formula C16H24IN5O and a molecular weight of 429.31 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111272644 |
| Molecular Formula | C16H24IN5O |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnn(C)c1)N(C)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C16H23N5O.HI/c1-17-16(18-9-14-10-19-21(3)12-14)20(2)11-13-5-7-15(22-4)8-6-13;/h5-8,10,12H,9,11H2,1-4H3,(H,17,18);1H |
| InChIKey | VSOIYSRDVGDNNJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|