C15H20BrN5 — CID 111276237
1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine (PubChem CID 111276237) has the molecular formula C15H20BrN5 and a molecular weight of 350.26 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111276237 |
| Molecular Formula | C15H20BrN5 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cnn(C)c1)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C15H20BrN5/c1-17-15(18-8-12-9-19-21(3)10-12)20(2)11-13-6-4-5-7-14(13)16/h4-7,9-10H,8,11H2,1-3H3,(H,17,18) |
| InChIKey | SRYIDCAULDQLBW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|