C14H18BrIN4S — CID 119131411
1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(1,3-thiazol-2-ylmethyl)guanidine;hydroiodide (PubChem CID 119131411) has the molecular formula C14H18BrIN4S and a molecular weight of 481.20 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(1,3-thiazol-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(1,3-thiazol-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119131411 |
| Molecular Formula | C14H18BrIN4S |
| Molecular Weight | 481.20 g/mol |
| Exact Mass | 479.95 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(1,3-thiazol-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nccs1)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C14H17BrN4S.HI/c1-16-14(18-9-13-17-7-8-20-13)19(2)10-11-5-3-4-6-12(11)15;/h3-8H,9-10H2,1-2H3,(H,16,18);1H |
| InChIKey | UKISKWHZUBFFPV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|