C15H21BrN6 — CID 111275989
1-[(2-bromophenyl)methyl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine (PubChem CID 111275989) has the molecular formula C15H21BrN6 and a molecular weight of 365.28 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111275989 |
| Molecular Formula | C15H21BrN6 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1,2-dimethylguanidine |
| SMILES | CCn1cnnc1CN/C(=N\C)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C15H21BrN6/c1-4-22-11-19-20-14(22)9-18-15(17-2)21(3)10-12-7-5-6-8-13(12)16/h5-8,11H,4,9-10H2,1-3H3,(H,17,18) |
| InChIKey | CRFFGUSAUVBNLN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|