C15H20FN5 — CID 111307712
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine (PubChem CID 111307712) has the molecular formula C15H20FN5 and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111307712 |
| Molecular Formula | C15H20FN5 |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cnn(C)c1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H20FN5/c1-17-15(18-8-13-9-19-21(3)11-13)20(2)10-12-4-6-14(16)7-5-12/h4-7,9,11H,8,10H2,1-3H3,(H,17,18) |
| InChIKey | YNFPFIZYVIOWFD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|