C22H30N4O3S — CID 111272297
1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111272297) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111272297 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCC2)cc1)N(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H30N4O3S/c1-23-22(25(2)17-19-6-10-20(29-3)11-7-19)24-16-18-8-12-21(13-9-18)30(27,28)26-14-4-5-15-26/h6-13H,4-5,14-17H2,1-3H3,(H,23,24) |
| InChIKey | WIFWMASZDVILAY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|