C22H28N4O2S — CID 111723019
N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 111723019) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723019 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC2CC2)cc1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H28N4O2S/c1-23-22(26-14-13-19(16-26)18-5-3-2-4-6-18)24-15-17-7-11-21(12-8-17)29(27,28)25-20-9-10-20/h2-8,11-12,19-20,25H,9-10,13-16H2,1H3,(H,23,24) |
| InChIKey | BCWNXQUQQZPJIF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|