C24H29N5O2 — CID 111724339
N'-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 111724339) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N'-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724339 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N'-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N2CCNC(=O)C2)cc1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C24H29N5O2/c1-25-24(29-13-11-21(16-29)19-5-3-2-4-6-19)27-15-18-7-9-20(10-8-18)23(31)28-14-12-26-22(30)17-28/h2-10,21H,11-17H2,1H3,(H,25,27)(H,26,30) |
| InChIKey | GUCOVGJKVDFIAG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|