C21H25N5O2 — CID 110952096
1-benzyl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine (PubChem CID 110952096) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine.
| Compound Name | 1-benzyl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 110952096 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-benzyl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1)NCc1ccc(C(=O)N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C21H25N5O2/c1-22-21(24-13-16-5-3-2-4-6-16)25-14-17-7-9-18(10-8-17)20(28)26-12-11-23-19(27)15-26/h2-10H,11-15H2,1H3,(H,23,27)(H2,22,24,25) |
| InChIKey | ZLOBLJGSTYDPRE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|