C21H30IN7O2 — CID 111951876
2-methyl-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111951876) has the molecular formula C21H30IN7O2 and a molecular weight of 539.42 g/mol. Its IUPAC name is 2-methyl-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111951876 |
| Molecular Formula | C21H30IN7O2 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 2-methyl-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C21H29N7O2.HI/c1-14-18(15(2)27(4)26-14)12-25-21(22-3)24-11-16-5-7-17(8-6-16)20(30)28-10-9-23-19(29)13-28;/h5-8H,9-13H2,1-4H3,(H,23,29)(H2,22,24,25);1H |
| InChIKey | LAYWMZISHVGSPF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|