C22H26IN5O4 — CID 111843799
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111843799) has the molecular formula C22H26IN5O4 and a molecular weight of 551.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111843799 |
| Molecular Formula | C22H26IN5O4 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C22H25N5O4.HI/c1-23-22(26-12-16-4-7-18-19(10-16)31-14-30-18)25-11-15-2-5-17(6-3-15)21(29)27-9-8-24-20(28)13-27;/h2-7,10H,8-9,11-14H2,1H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | ITSQAZMUNJFYME-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|