C18H28IN5O2 — CID 110943005
1-butan-2-yl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110943005) has the molecular formula C18H28IN5O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110943005 |
| Molecular Formula | C18H28IN5O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 1-butan-2-yl-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCc1ccc(C(=O)N2CCNC(=O)C2)cc1.I |
| InChI | InChI=1S/C18H27N5O2.HI/c1-4-13(2)22-18(19-3)21-11-14-5-7-15(8-6-14)17(25)23-10-9-20-16(24)12-23;/h5-8,13H,4,9-12H2,1-3H3,(H,20,24)(H2,19,21,22);1H |
| InChIKey | GUQQBMAVHHXAPI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|