C20H26N6O3 — CID 109428555
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine (PubChem CID 109428555) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109428555 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C20H26N6O3/c1-13-14(2)29-18(25-13)11-24-20(21-3)23-10-15-4-6-16(7-5-15)19(28)26-9-8-22-17(27)12-26/h4-7H,8-12H2,1-3H3,(H,22,27)(H2,21,23,24) |
| InChIKey | DAEPACKOXCFQQZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|