C23H30IN5O4 — CID 111879352
1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111879352) has the molecular formula C23H30IN5O4 and a molecular weight of 567.43 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111879352 |
| Molecular Formula | C23H30IN5O4 |
| Molecular Weight | 567.43 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N2CCNC(=O)C2)cc1)NCc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C23H29N5O4.HI/c1-24-23(27-14-18-8-9-19(31-2)12-20(18)32-3)26-13-16-4-6-17(7-5-16)22(30)28-11-10-25-21(29)15-28;/h4-9,12H,10-11,13-15H2,1-3H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | MGMZPYVSYCNQJX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|