C22H28IN5O4 — CID 111048695
2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111048695) has the molecular formula C22H28IN5O4 and a molecular weight of 553.40 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111048695 |
| Molecular Formula | C22H28IN5O4 |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCc2ccc(C(=O)N3CCNC(=O)C3)cc2)cc1OC.I |
| InChI | InChI=1S/C22H27N5O4.HI/c1-30-18-8-5-16(11-19(18)31-2)13-26-22(23)25-12-15-3-6-17(7-4-15)21(29)27-10-9-24-20(28)14-27;/h3-8,11H,9-10,12-14H2,1-2H3,(H,24,28)(H3,23,25,26);1H |
| InChIKey | KOVOCGUQBMPNKY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|