C17H24N4O3 — CID 119283797
(2S)-2-amino-3-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]butanamide (PubChem CID 119283797) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 119283797 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]butanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCc1ccc(C(=O)N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C17H24N4O3/c1-11(2)15(18)16(23)20-9-12-3-5-13(6-4-12)17(24)21-8-7-19-14(22)10-21/h3-6,11,15H,7-10,18H2,1-2H3,(H,19,22)(H,20,23)/t15-/m0/s1 |
| InChIKey | FUWAPMDDWNTLRK-HNNXBMFYSA-N |
| XLogP | -0.14 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |