C18H24N4O2S2 — CID 119142931
N'-methyl-3-(2-methylphenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 119142931) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N'-methyl-3-(2-methylphenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(2-methylphenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119142931 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N'-methyl-3-(2-methylphenyl)-N-[(5-sulfamoylthiophen-2-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)s1)N1CCC(c2ccccc2C)C1 |
| InChI | InChI=1S/C18H24N4O2S2/c1-13-5-3-4-6-16(13)14-9-10-22(12-14)18(20-2)21-11-15-7-8-17(25-15)26(19,23)24/h3-8,14H,9-12H2,1-2H3,(H,20,21)(H2,19,23,24) |
| InChIKey | MIKVPQUTCHRMKS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|