C20H28N4O3S2 — CID 109479451
N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide (PubChem CID 109479451) has the molecular formula C20H28N4O3S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide.
| Compound Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109479451 |
| Molecular Formula | C20H28N4O3S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-2-(2-methylphenyl)morpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N(C)C)s1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C20H28N4O3S2/c1-15-7-5-6-8-17(15)18-14-24(11-12-27-18)20(21-2)22-13-16-9-10-19(28-16)29(25,26)23(3)4/h5-10,18H,11-14H2,1-4H3,(H,21,22) |
| InChIKey | TVSQJTJKLXCLCJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|