C20H28N4O2S2 — CID 111724439
3-benzyl-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111724439) has the molecular formula C20H28N4O2S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 3-benzyl-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | 3-benzyl-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724439 |
| Molecular Formula | C20H28N4O2S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3-benzyl-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N(C)C)s1)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H28N4O2S2/c1-21-20(22-14-18-9-10-19(27-18)28(25,26)23(2)3)24-12-11-17(15-24)13-16-7-5-4-6-8-16/h4-10,17H,11-15H2,1-3H3,(H,21,22) |
| InChIKey | OSGLHYCFZPOURI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|