C19H27N5O2S2 — CID 111909431
1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine (PubChem CID 111909431) has the molecular formula C19H27N5O2S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine.
| Compound Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine |
|---|---|
| PubChem CID | 111909431 |
| Molecular Formula | C19H27N5O2S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N(C)C)s1)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C19H27N5O2S2/c1-20-19(21-13-17-9-10-18(27-17)28(25,26)23(2)3)22-15-11-12-24(14-15)16-7-5-4-6-8-16/h4-10,15H,11-14H2,1-3H3,(H2,20,21,22) |
| InChIKey | RLIZVOGFUZFVEV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|