C17H28N4O2S2 — CID 109441757
N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109441757) has the molecular formula C17H28N4O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109441757 |
| Molecular Formula | C17H28N4O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N(C)C)s1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C17H28N4O2S2/c1-18-17(21-11-13-6-4-5-7-14(13)12-21)19-10-15-8-9-16(24-15)25(22,23)20(2)3/h8-9,13-14H,4-7,10-12H2,1-3H3,(H,18,19) |
| InChIKey | UGZBBMFXLDQHHW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|