C9H15N3O3S2 — CID 47132005
1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-methylurea (PubChem CID 47132005) has the molecular formula C9H15N3O3S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-methylurea.
| Compound Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-methylurea |
|---|---|
| PubChem CID | 47132005 |
| Molecular Formula | C9H15N3O3S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1ccc(S(=O)(=O)N(C)C)s1 |
| InChI | InChI=1S/C9H15N3O3S2/c1-10-9(13)11-6-7-4-5-8(16-7)17(14,15)12(2)3/h4-5H,6H2,1-3H3,(H2,10,11,13) |
| InChIKey | FCUICYYGSURZIB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |