C18H17FN2O3S3 — CID 33307839
N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-5-(4-fluorophenyl)thiophene-2-carboxamide (PubChem CID 33307839) has the molecular formula C18H17FN2O3S3 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-5-(4-fluorophenyl)thiophene-2-carboxamide.
| Compound Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-5-(4-fluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 33307839 |
| Molecular Formula | C18H17FN2O3S3 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-5-(4-fluorophenyl)thiophene-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNC(=O)c2ccc(-c3ccc(F)cc3)s2)s1 |
| InChI | InChI=1S/C18H17FN2O3S3/c1-21(2)27(23,24)17-10-7-14(25-17)11-20-18(22)16-9-8-15(26-16)12-3-5-13(19)6-4-12/h3-10H,11H2,1-2H3,(H,20,22) |
| InChIKey | MMNTTXUNBSXCSU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |