C12H14N2O3S3 — CID 33152535
N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 33152535) has the molecular formula C12H14N2O3S3 and a molecular weight of 330.46 g/mol. Its IUPAC name is N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 33152535 |
| Molecular Formula | C12H14N2O3S3 |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNC(=O)c2cccs2)s1 |
| InChI | InChI=1S/C12H14N2O3S3/c1-14(2)20(16,17)11-6-5-9(19-11)8-13-12(15)10-4-3-7-18-10/h3-7H,8H2,1-2H3,(H,13,15) |
| InChIKey | WBSALBBYDDMRAN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |