C17H20N4O3S2 — CID 51941434
(2S)-2-(benzimidazol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]propanamide (PubChem CID 51941434) has the molecular formula C17H20N4O3S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is (2S)-2-(benzimidazol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]propanamide.
| Compound Name | (2S)-2-(benzimidazol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 51941434 |
| Molecular Formula | C17H20N4O3S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2S)-2-(benzimidazol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(S(=O)(=O)N(C)C)s1)n1cnc2ccccc21 |
| InChI | InChI=1S/C17H20N4O3S2/c1-12(21-11-19-14-6-4-5-7-15(14)21)17(22)18-10-13-8-9-16(25-13)26(23,24)20(2)3/h4-9,11-12H,10H2,1-3H3,(H,18,22)/t12-/m0/s1 |
| InChIKey | HZQLEAHAEKELIO-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |