C20H23N3O3S2 — CID 33306976
4-(2,5-dimethylpyrrol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]benzamide (PubChem CID 33306976) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 33306976 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)NCc2ccc(S(=O)(=O)N(C)C)s2)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-14-5-6-15(2)23(14)17-9-7-16(8-10-17)20(24)21-13-18-11-12-19(27-18)28(25,26)22(3)4/h5-12H,13H2,1-4H3,(H,21,24) |
| InChIKey | PIJOKFHNMGMUDD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|