C17H23N3O5S3 — CID 24598621
N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-4-(methylsulfamoyl)benzamide (PubChem CID 24598621) has the molecular formula C17H23N3O5S3 and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-4-(methylsulfamoyl)benzamide.
| Compound Name | N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-4-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24598621 |
| Molecular Formula | C17H23N3O5S3 |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-4-(methylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)c2ccc(S(=O)(=O)NC)cc2)s1 |
| InChI | InChI=1S/C17H23N3O5S3/c1-4-20(5-2)28(24,25)16-11-8-14(26-16)12-19-17(21)13-6-9-15(10-7-13)27(22,23)18-3/h6-11,18H,4-5,12H2,1-3H3,(H,19,21) |
| InChIKey | SJHWBRPASUHFAW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |