C16H19FN2O3S2 — CID 18140594
N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-fluorobenzamide (PubChem CID 18140594) has the molecular formula C16H19FN2O3S2 and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-fluorobenzamide.
| Compound Name | N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 18140594 |
| Molecular Formula | C16H19FN2O3S2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)c2cccc(F)c2)s1 |
| InChI | InChI=1S/C16H19FN2O3S2/c1-3-19(4-2)24(21,22)15-9-8-14(23-15)11-18-16(20)12-6-5-7-13(17)10-12/h5-10H,3-4,11H2,1-2H3,(H,18,20) |
| InChIKey | PGXFAKVANREULP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |