C20H29N3O3S2 — CID 24613018
1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-(2-methyl-1-phenylpropyl)urea (PubChem CID 24613018) has the molecular formula C20H29N3O3S2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-(2-methyl-1-phenylpropyl)urea.
| Compound Name | 1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-(2-methyl-1-phenylpropyl)urea |
|---|---|
| PubChem CID | 24613018 |
| Molecular Formula | C20H29N3O3S2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-(2-methyl-1-phenylpropyl)urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NC(c2ccccc2)C(C)C)s1 |
| InChI | InChI=1S/C20H29N3O3S2/c1-5-23(6-2)28(25,26)18-13-12-17(27-18)14-21-20(24)22-19(15(3)4)16-10-8-7-9-11-16/h7-13,15,19H,5-6,14H2,1-4H3,(H2,21,22,24) |
| InChIKey | XCTJTQQQMIRILX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |