C18H24FN3O3S2 — CID 24612971
1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-[1-(4-fluorophenyl)ethyl]urea (PubChem CID 24612971) has the molecular formula C18H24FN3O3S2 and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-[1-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-[1-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 24612971 |
| Molecular Formula | C18H24FN3O3S2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-[[5-(diethylsulfamoyl)thiophen-2-yl]methyl]-3-[1-(4-fluorophenyl)ethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NC(C)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H24FN3O3S2/c1-4-22(5-2)27(24,25)17-11-10-16(26-17)12-20-18(23)21-13(3)14-6-8-15(19)9-7-14/h6-11,13H,4-5,12H2,1-3H3,(H2,20,21,23) |
| InChIKey | AZHHNAOTNVYYET-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |