C16H25N3O5S2 — CID 24574536
ethyl 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methylcarbamoyl]piperidine-4-carboxylate (PubChem CID 24574536) has the molecular formula C16H25N3O5S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is ethyl 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methylcarbamoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methylcarbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 24574536 |
| Molecular Formula | C16H25N3O5S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | ethyl 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methylcarbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)NCc2ccc(S(=O)(=O)N(C)C)s2)CC1 |
| InChI | InChI=1S/C16H25N3O5S2/c1-4-24-15(20)12-7-9-19(10-8-12)16(21)17-11-13-5-6-14(25-13)26(22,23)18(2)3/h5-6,12H,4,7-11H2,1-3H3,(H,17,21) |
| InChIKey | LXXUDTNOKZCLFR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |