C18H21FN2O3S — CID 60562915
ethyl 1-[(5-fluoro-1-benzothiophen-2-yl)methylcarbamoyl]piperidine-4-carboxylate (PubChem CID 60562915) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl 1-[(5-fluoro-1-benzothiophen-2-yl)methylcarbamoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(5-fluoro-1-benzothiophen-2-yl)methylcarbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 60562915 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl 1-[(5-fluoro-1-benzothiophen-2-yl)methylcarbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)NCc2cc3cc(F)ccc3s2)CC1 |
| InChI | InChI=1S/C18H21FN2O3S/c1-2-24-17(22)12-5-7-21(8-6-12)18(23)20-11-15-10-13-9-14(19)3-4-16(13)25-15/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,20,23) |
| InChIKey | NSMAVOOVIHLHDS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |