C17H17FN4OS — CID 138027813
N-[(5-fluoro-1-benzothiophen-2-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide (PubChem CID 138027813) has the molecular formula C17H17FN4OS and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[(5-fluoro-1-benzothiophen-2-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N-[(5-fluoro-1-benzothiophen-2-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 138027813 |
| Molecular Formula | C17H17FN4OS |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[(5-fluoro-1-benzothiophen-2-yl)methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
| SMILES | Cc1nc2n(n1)CC(C(=O)NCc1cc3cc(F)ccc3s1)CC2 |
| InChI | InChI=1S/C17H17FN4OS/c1-10-20-16-5-2-11(9-22(16)21-10)17(23)19-8-14-7-12-6-13(18)3-4-15(12)24-14/h3-4,6-7,11H,2,5,8-9H2,1H3,(H,19,23) |
| InChIKey | UXUOQSITNRWKMR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |