C15H19FN2O3S — CID 124851471
1-[(5-fluoro-1-benzothiophen-2-yl)methyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea (PubChem CID 124851471) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-[(5-fluoro-1-benzothiophen-2-yl)methyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea.
| Compound Name | 1-[(5-fluoro-1-benzothiophen-2-yl)methyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea |
|---|---|
| PubChem CID | 124851471 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1-[(5-fluoro-1-benzothiophen-2-yl)methyl]-3-[(2R)-1-hydroxy-4-methoxybutan-2-yl]urea |
| SMILES | COCC[C@H](CO)NC(=O)NCc1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C15H19FN2O3S/c1-21-5-4-12(9-19)18-15(20)17-8-13-7-10-6-11(16)2-3-14(10)22-13/h2-3,6-7,12,19H,4-5,8-9H2,1H3,(H2,17,18,20)/t12-/m1/s1 |
| InChIKey | SJMXNHATWGSZDO-GFCCVEGCSA-N |
| XLogP | 2.24 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |